ChemNet > CAS > 13679-72-6 2-acetyl-3-methylthiophene
13679-72-6 2-acetyl-3-methylthiophene
שם המוצר |
2-acetyl-3-methylthiophene |
שם אנגלי |
2-acetyl-3-methylthiophene; 1-(3-methylthiophen-2-yl)ethanone; 2-acetyl-3-methyl thiophene |
מולקולרית פורמולה |
C7H8OS |
משקל מולקולרי |
140.2028 |
InChI |
InChI=1/C7H8OS/c1-5-3-4-9-7(5)6(2)8/h3-4H,1-2H3 |
מספר CAS |
13679-72-6 |
EINECS |
237-179-1 |
מבנה מולקולרי |
|
צפיפות |
1.106g/cm3 |
נקודת רתיחה |
214.9°C at 760 mmHg |
משקל סגולי |
1.535 |
נקודת הבזק |
92.3°C |
לחץ אדים |
0.152mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
בטיחות תיאור |
S36/37:Wear suitable protective clothing and gloves.;
|
|