ChemNet > CAS > 14282-78-1 4-methylthiophene-2-carboxylic acid
14282-78-1 4-methylthiophene-2-carboxylic acid
שם המוצר |
4-methylthiophene-2-carboxylic acid |
שם אנגלי |
4-methylthiophene-2-carboxylic acid; |
מולקולרית פורמולה |
C6H6O2S |
משקל מולקולרי |
142.1756 |
InChI |
InChI=1/C6H6O2S/c1-4-2-5(6(7)8)9-3-4/h2-3H,1H3,(H,7,8) |
מספר CAS |
14282-78-1 |
מבנה מולקולרי |
|
צפיפות |
1.319g/cm3 |
נקודת ההתוך |
122℃ |
נקודת רתיחה |
277.2°C at 760 mmHg |
משקל סגולי |
1.59 |
נקודת הבזק |
121.5°C |
לחץ אדים |
0.0022mmHg at 25°C |
Hazard סימנים |
Xi:Irritant;
|
סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|