144693-65-2 4-Ethynylbenzoic acid sodium salt

שם המוצר	4-Ethynylbenzoic acid sodium salt
שם אנגלי	4-Ethynylbenzoic acid sodium salt; (4-Carboxyphenyl)acetylene sodium salt~Sodium 4-ethynylbenzoate; sodium 4-ethynylbenzoate
מולקולרית פורמולה	C₉H₅NaO₂
משקל מולקולרי	168.1246
InChI	InChI=1/C9H6O2.Na/c1-2-7-3-5-8(6-4-7)9(10)11;/h1,3-6H,(H,10,11);/q;+1/p-1
מספר CAS	144693-65-2
מבנה מולקולרי
Hazard סימנים
סיכונים קודי	R36/37/38:Irritating to eyes, respiratory system and skin.;
בטיחות תיאור	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;