ChemNet > CAS > 1475-12-3 1-(2,5-Dichlorophenyl)אתנול
1475-12-3 1-(2,5-Dichlorophenyl)אתנול
שם המוצר |
1-(2,5-Dichlorophenyl)אתנול |
נרדפות |
; 2,5-Dichloro-alpha-methylbenzyl אלכוהול ~ 2,5-Dichlorophenyl מתיל carbinol; 2,5-Dichlorophenyl אתנול |
שם אנגלי |
1-(2,5-Dichlorophenyl)ethanol; 2,5-Dichloro-alpha-methylbenzyl alcohol~2,5-Dichlorophenyl methyl carbinol; 2,5-Dichlorophenyl Ethanol |
מולקולרית פורמולה |
C8H8Cl2O |
משקל מולקולרי |
191.0545 |
InChI |
InChI=1/C8H8Cl2O/c1-5(11)7-4-6(9)2-3-8(7)10/h2-5,11H,1H3 |
מספר CAS |
1475-12-3 |
EINECS |
216-018-9 |
מבנה מולקולרי |
|
צפיפות |
1.323g/cm3 |
נקודת רתיחה |
257.9°C at 760 mmHg |
משקל סגולי |
1.566 |
נקודת הבזק |
112.1°C |
לחץ אדים |
0.00725mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
|
בטיחות תיאור |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|