ChemNet > CAS > 1501-27-5 mono-methyl glutarate
1501-27-5 mono-methyl glutarate
שם המוצר |
mono-methyl glutarate |
שם אנגלי |
mono-methyl glutarate; Methyl hydrogen glutarate; Glutaric acid monomethyl ester; Monomethyl glutarate; Pentanedioic acid monomethyl ester; Monoethyl Glutaric Acid; 5-methoxy-5-oxopentanoic acid; 5-methoxy-5-oxopentanoate; 5-{[5-methyl-2-(propan-2-yl)cyclohexyl]oxy}-5-oxopentanoic acid |
מולקולרית פורמולה |
C15H26O4 |
משקל מולקולרי |
270.3645 |
InChI |
InChI=1/C15H26O4/c1-10(2)12-8-7-11(3)9-13(12)19-15(18)6-4-5-14(16)17/h10-13H,4-9H2,1-3H3,(H,16,17) |
מספר CAS |
1501-27-5 |
EINECS |
216-116-1 |
מבנה מולקולרי |
|
צפיפות |
1.05g/cm3 |
נקודת רתיחה |
393.406°C at 760 mmHg |
משקל סגולי |
1.478 |
נקודת הבזק |
137.448°C |
לחץ אדים |
0mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
R36/38:Irritating to eyes and skin.;
|
בטיחות תיאור |
S23:;
S24/25:;
|
|