ChemNet > CAS > 15816-71-4 octanoic acid, compound with dicyclohexylamine (1:1)
15816-71-4 octanoic acid, compound with dicyclohexylamine (1:1)
| שם המוצר |
octanoic acid, compound with dicyclohexylamine (1:1) |
| שם אנגלי |
octanoic acid, compound with dicyclohexylamine (1:1); Octanoic acid, compound with dicyclohexylamine (1:1); Dicyclohexylamine caprylate; N-cyclohexylcyclohexanaminium octanoate |
| מולקולרית פורמולה |
C20H39NO2 |
| משקל מולקולרי |
325.5292 |
| InChI |
InChI=1/C12H23N.C8H16O2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-3-4-5-6-7-8(9)10/h11-13H,1-10H2;2-7H2,1H3,(H,9,10) |
| מספר CAS |
15816-71-4 |
| EINECS |
239-914-1 |
| מבנה מולקולרי |
|
| נקודת רתיחה |
466.8°C at 760 mmHg |
| נקודת הבזק |
236.1°C |
| לחץ אדים |
5.25E-10mmHg at 25°C |
| Hazard סימנים |
|
| סיכונים קודי |
|
| בטיחות תיאור |
|
|
