ChemNet > CAS > 161446-90-8 3-Chloro-4-fluorobenzyl alcohol
161446-90-8 3-Chloro-4-fluorobenzyl alcohol
| שם המוצר |
3-Chloro-4-fluorobenzyl alcohol |
| שם אנגלי |
3-Chloro-4-fluorobenzyl alcohol; (3-chloro-4-fluorophenyl)methanol; 3-Chloro-4-fluorobenzyla alcohol |
| מולקולרית פורמולה |
C7H6ClFO |
| משקל מולקולרי |
160.5733 |
| InChI |
InChI=1/C7H6ClFO/c8-6-3-5(4-10)1-2-7(6)9/h1-3,10H,4H2 |
| מספר CAS |
161446-90-8 |
| מבנה מולקולרי |
|
| צפיפות |
1.344g/cm3 |
| נקודת רתיחה |
242.5°C at 760 mmHg |
| משקל סגולי |
1.542 |
| נקודת הבזק |
100.4°C |
| לחץ אדים |
0.0183mmHg at 25°C |
| Hazard סימנים |
|
| סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
