ChemNet > CAS > 164298-25-3 Bis(tetramethylene)fluoroformamidinium hexafluorophosphate
164298-25-3 Bis(tetramethylene)fluoroformamidinium hexafluorophosphate
שם המוצר |
Bis(tetramethylene)fluoroformamidinium hexafluorophosphate |
שם אנגלי |
Bis(tetramethylene)fluoroformamidinium hexafluorophosphate; BTFFH~Fluorobis(tetramethylene)formamidinium hexafluorophosphate; Fluoro-N,N,N,N-bis(tetramethylene)formamidinium hexafluorophosphate; 1-[fluoro(pyrrolidin-1-yl)methylidene]pyrrolidinium hexafluorophosphate; BTFFH |
מולקולרית פורמולה |
C9H16F7N2P |
משקל מולקולרי |
171.23 |
InChI |
InChI=1/C9H16FN2.F6P/c10-9(11-5-1-2-6-11)12-7-3-4-8-12;1-7(2,3,4,5)6/h1-8H2;/q+1;-1 |
מספר CAS |
164298-25-3 |
מבנה מולקולרי |
|
נקודת ההתוך |
152-157℃ |
Hazard סימנים |
|
סיכונים קודי |
R34:Causes burns.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|