ChemNet > CAS > 16689-02-4 5-Nitrothiophene-2-carbonitrile
16689-02-4 5-Nitrothiophene-2-carbonitrile
| שם המוצר |
5-Nitrothiophene-2-carbonitrile |
| שם אנגלי |
5-Nitrothiophene-2-carbonitrile; 2-Cyano-5-nitrothiophene |
| מולקולרית פורמולה |
C5H2N2O2S |
| משקל מולקולרי |
154.1466 |
| InChI |
InChI=1/C5H2N2O2S/c6-3-4-1-2-5(10-4)7(8)9/h1-2H |
| מספר CAS |
16689-02-4 |
| מבנה מולקולרי |
|
| צפיפות |
1.5g/cm3 |
| נקודת רתיחה |
273.9°C at 760 mmHg |
| משקל סגולי |
1.611 |
| נקודת הבזק |
119.4°C |
| לחץ אדים |
0.00558mmHg at 25°C |
| Hazard סימנים |
|
| סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| בטיחות תיאור |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
