1711-10-0 3-iodobenzoyl chloride

שם המוצר	3-iodobenzoyl chloride
שם אנגלי	3-iodobenzoyl chloride;
מולקולרית פורמולה	C₇H₄ClIO
משקל מולקולרי	266.46
InChI	InChI=1/C7H4ClIO/c8-7(10)5-2-1-3-6(9)4-5/h1-4H
מספר CAS	1711-10-0
EINECS	216-979-4
מבנה מולקולרי
Hazard סימנים
סיכונים קודי	R34:Causes burns.;
בטיחות תיאור	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;