ChemNet > CAS > 18196-80-0 N-(3-Chlorophenyl)maleamic acid
18196-80-0 N-(3-Chlorophenyl)maleamic acid
שם המוצר |
N-(3-Chlorophenyl)maleamic acid |
שם אנגלי |
N-(3-Chlorophenyl)maleamic acid; Maleic acid mono(3-chlorophenyl)amide; (2Z)-4-[(3-chlorophenyl)amino]-4-oxobut-2-enoic acid; (2E)-4-[(3-chlorophenyl)amino]-4-oxobut-2-enoate |
מולקולרית פורמולה |
C10H7ClNO3 |
משקל מולקולרי |
224.621 |
InChI |
InChI=1/C10H8ClNO3/c11-7-2-1-3-8(6-7)12-9(13)4-5-10(14)15/h1-6H,(H,12,13)(H,14,15)/p-1/b5-4+ |
מספר CAS |
18196-80-0 |
מבנה מולקולרי |
|
נקודת רתיחה |
463.9°C at 760 mmHg |
נקודת הבזק |
234.3°C |
לחץ אדים |
2.1E-09mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|