ChemNet > CAS > 18984-21-9 2,4-Dichloro-beta-nitrostyrene
18984-21-9 2,4-Dichloro-beta-nitrostyrene
שם המוצר |
2,4-Dichloro-beta-nitrostyrene |
שם אנגלי |
2,4-Dichloro-beta-nitrostyrene; 1-(2,4-Dichlorophenyl)-2-nitroethene; 2,4-dichloro-1-(2-nitroethenyl)benzene; 2,4-dichloro-1-[(E)-2-nitroethenyl]benzene |
מולקולרית פורמולה |
C8H5Cl2NO2 |
משקל מולקולרי |
218.0368 |
InChI |
InChI=1/C8H5Cl2NO2/c9-7-2-1-6(8(10)5-7)3-4-11(12)13/h1-5H/b4-3+ |
מספר CAS |
18984-21-9 |
מבנה מולקולרי |
|
צפיפות |
1.447g/cm3 |
נקודת רתיחה |
334.1°C at 760 mmHg |
משקל סגולי |
1.626 |
נקודת הבזק |
155.9°C |
לחץ אדים |
0.000253mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|