ChemNet > CAS > 19241-19-1 2-ethylphenyl isothiocyanate
19241-19-1 2-ethylphenyl isothiocyanate
| שם המוצר |
2-ethylphenyl isothiocyanate |
| שם אנגלי |
2-ethylphenyl isothiocyanate; 2-Ethylisothiocyanatobenzene; 1-ethyl-2-isothiocyanatobenzene |
| מולקולרית פורמולה |
C9H9NS |
| משקל מולקולרי |
163.2395 |
| InChI |
InChI=1/C9H9NS/c1-2-8-5-3-4-6-9(8)10-7-11/h3-6H,2H2,1H3 |
| מספר CAS |
19241-19-1 |
| מבנה מולקולרי |
|
| צפיפות |
1.01g/cm3 |
| נקודת רתיחה |
264.8°C at 760 mmHg |
| משקל סגולי |
1.553 |
| נקודת הבזק |
115.1°C |
| לחץ אדים |
0.0155mmHg at 25°C |
| Hazard סימנים |
|
| סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
