1968-40-7 Ethyl pent-4-enoate
שם המוצר |
Ethyl pent-4-enoate |
שם אנגלי |
Ethyl pent-4-enoate; Ethyl pent-4-enoate, (Ethyl allylacetate; Pent-4-enoic aci; Ethyl allylacetate; 4-Pentenoic acid ethyl ester; Ethyl 4-pentenoate |
מולקולרית פורמולה |
C7H12O2 |
משקל מולקולרי |
128.169 |
InChI |
InChI=1/C7H12O2/c1-3-5-6-7(8)9-4-2/h3H,1,4-6H2,2H3 |
מספר CAS |
1968-40-7 |
EINECS |
217-818-0 |
מבנה מולקולרי |
|
צפיפות |
0.898g/cm3 |
נקודת רתיחה |
122.8°C at 760 mmHg |
משקל סגולי |
1.418 |
נקודת הבזק |
33.7°C |
לחץ אדים |
13.7mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|