ChemNet > CAS > 2024-83-1 3,4-Dimethoxybenzonitrile
2024-83-1 3,4-Dimethoxybenzonitrile
שם המוצר |
3,4-Dimethoxybenzonitrile |
שם אנגלי |
3,4-Dimethoxybenzonitrile; Veratronitrile; 3,4-Dimethoybenzonitrile |
מולקולרית פורמולה |
C9H9NO2 |
משקל מולקולרי |
163.1733 |
InChI |
InChI=1/C9H9NO2/c1-11-8-4-3-7(6-10)5-9(8)12-2/h3-5H,1-2H3 |
מספר CAS |
2024-83-1 |
EINECS |
217-969-2 |
מבנה מולקולרי |
|
צפיפות |
1.12g/cm3 |
נקודת ההתוך |
66-71℃ |
נקודת רתיחה |
266.2°C at 760 mmHg |
משקל סגולי |
1.519 |
נקודת הבזק |
107.5°C |
לחץ אדים |
0.00877mmHg at 25°C |
Hazard סימנים |
Xn:Harmful;
|
סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
בטיחות תיאור |
S36/37:Wear suitable protective clothing and gloves.;
|
|