ChemNet > CAS > 20261-31-8 4-Hydroxy-3-nitrocoumarin
20261-31-8 4-Hydroxy-3-nitrocoumarin
שם המוצר |
4-Hydroxy-3-nitrocoumarin |
שם אנגלי |
4-Hydroxy-3-nitrocoumarin; 3-NITRO-4-HYDROXYCOUMARIN; 2-hydroxy-3-nitro-4H-chromen-4-one; 4-hydroxy-3-nitro-2H-chromen-2-one |
מולקולרית פורמולה |
C9H5NO5 |
משקל מולקולרי |
207.1397 |
InChI |
InChI=1/C9H5NO5/c11-8-5-3-1-2-4-6(5)15-9(12)7(8)10(13)14/h1-4,11H |
מספר CAS |
20261-31-8 |
מבנה מולקולרי |
|
צפיפות |
1.638g/cm3 |
נקודת ההתוך |
171-173℃ |
נקודת רתיחה |
364.492°C at 760 mmHg |
משקל סגולי |
1.674 |
נקודת הבזק |
174.239°C |
לחץ אדים |
0mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|