ChemNet > CAS > 202865-73-4 2-Bromo-4-fluoro-1-iodobenzene
202865-73-4 2-Bromo-4-fluoro-1-iodobenzene
שם המוצר |
2-Bromo-4-fluoro-1-iodobenzene |
שם אנגלי |
2-Bromo-4-fluoro-1-iodobenzene; 2-Bromo-4-fluoroiodobenzene; 1-Bromo-5-fluoro-2-iodobenzene |
מולקולרית פורמולה |
C6H3BrFI |
משקל מולקולרי |
300.8949 |
InChI |
InChI=1/C6H3BrFI/c7-5-3-4(8)1-2-6(5)9/h1-3H |
מספר CAS |
202865-73-4 |
מבנה מולקולרי |
|
צפיפות |
2.281g/cm3 |
נקודת רתיחה |
243.2°C at 760 mmHg |
משקל סגולי |
1.628 |
נקודת הבזק |
100.9°C |
לחץ אדים |
0.0507mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|