ChemNet > CAS > 2049-67-4 diethyl glutaconate, mixture of cis and tra
2049-67-4 diethyl glutaconate, mixture of cis and tra
שם המוצר |
diethyl glutaconate, mixture of cis and tra |
שם אנגלי |
diethyl glutaconate, mixture of cis and tra; Diethyl glutaconate,mixture of cis and trans; diethyl pent-2-enedioate; diethyl (2E)-pent-2-enedioate; diethyl (2Z)-pent-2-enedioate; 2-Pentenedioic acid,1,5-diethyl ester; Diethyl glutaconate |
מולקולרית פורמולה |
C9H14O4 |
משקל מולקולרי |
186.2051 |
InChI |
InChI=1/C9H14O4/c1-3-12-8(10)6-5-7-9(11)13-4-2/h5-6H,3-4,7H2,1-2H3/b6-5- |
מספר CAS |
2049-67-4 |
EINECS |
218-069-2 |
מבנה מולקולרי |
|
צפיפות |
1.048g/cm3 |
נקודת רתיחה |
237°C at 760 mmHg |
משקל סגולי |
1.445 |
נקודת הבזק |
106.7°C |
לחץ אדים |
0.0459mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
|
בטיחות תיאור |
|
|