ChemNet > CAS > 2050-23-9 Diethyl suberate
2050-23-9 Diethyl suberate
| שם המוצר |
Diethyl suberate |
| שם אנגלי |
Diethyl suberate; Diethyl suberate, (Diethyl octanedioate; Suberic acid d; 2050-23-9Diethyl suberate; Diethyl octanedioate~Suberic acid diethyl ester; Octanedioic acid diethyl ester~Suberic acid diethyl ester; diethyl octanedioate |
| מולקולרית פורמולה |
C12H22O4 |
| משקל מולקולרי |
230.3007 |
| InChI |
InChI=1/C12H22O4/c1-3-15-11(13)9-7-5-6-8-10-12(14)16-4-2/h3-10H2,1-2H3 |
| מספר CAS |
2050-23-9 |
| EINECS |
218-084-4 |
| מבנה מולקולרי |
|
| צפיפות |
0.985g/cm3 |
| נקודת ההתוך |
5-284℃ |
| נקודת רתיחה |
282.6°C at 760 mmHg |
| משקל סגולי |
1.436 |
| נקודת הבזק |
123.3°C |
| לחץ אדים |
0.00332mmHg at 25°C |
| Hazard סימנים |
|
| סיכונים קודי |
|
| בטיחות תיאור |
S24/25:Avoid contact with skin and eyes.;
|
|
