ChemNet > CAS > 207974-19-4 2,3-difluoromandelic acid
207974-19-4 2,3-difluoromandelic acid
שם המוצר |
2,3-difluoromandelic acid |
שם אנגלי |
2,3-difluoromandelic acid; alpha-Hydroxy-2,3-difluorophenylacetic acid; (2,3-difluorophenyl)(hydroxy)acetic acid |
מולקולרית פורמולה |
C8H6F2O3 |
משקל מולקולרי |
188.1282 |
InChI |
InChI=1/C8H6F2O3/c9-5-3-1-2-4(6(5)10)7(11)8(12)13/h1-3,7,11H,(H,12,13) |
מספר CAS |
207974-19-4 |
מבנה מולקולרי |
|
צפיפות |
1.522g/cm3 |
נקודת רתיחה |
313.3°C at 760 mmHg |
משקל סגולי |
1.542 |
נקודת הבזק |
143.3°C |
לחץ אדים |
0.000213mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|