2113-58-8 3-Nitrobiphenyl
שם המוצר |
3-Nitrobiphenyl |
שם אנגלי |
3-Nitrobiphenyl; 3-Nitrodiphenyl |
מולקולרית פורמולה |
C12H9NO2 |
משקל מולקולרי |
199.2054 |
InChI |
InChI=1/C12H9NO2/c14-13(15)12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9H |
מספר CAS |
2113-58-8 |
EINECS |
218-305-4 |
מבנה מולקולרי |
|
צפיפות |
1.196g/cm3 |
נקודת ההתוך |
56-60℃ |
נקודת רתיחה |
339°C at 760 mmHg |
משקל סגולי |
1.605 |
נקודת הבזק |
161.4°C |
לחץ אדים |
0.000186mmHg at 25°C |
Hazard סימנים |
Xn:Harmful;
|
סיכונים קודי |
R40:Possible risks of irreversible effects.;
|
בטיחות תיאור |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|