ChemNet > CAS > 2145-31-5 3-(trifluoromethyl)phenoxyacetonitrile
2145-31-5 3-(trifluoromethyl)phenoxyacetonitrile
שם המוצר |
3-(trifluoromethyl)phenoxyacetonitrile |
שם אנגלי |
3-(trifluoromethyl)phenoxyacetonitrile; 2-[3-(Trifluoromethyl)phenoxy]acetonitrile; methyl 4-fluoro-3-hydroxybenzoate |
מולקולרית פורמולה |
C8H7FO3 |
משקל מולקולרי |
170.1378 |
InChI |
InChI=1/C8H7FO3/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4,10H,1H3 |
מספר CAS |
2145-31-5 |
מבנה מולקולרי |
|
צפיפות |
1.309g/cm3 |
נקודת רתיחה |
268.9°C at 760 mmHg |
משקל סגולי |
1.526 |
נקודת הבזק |
116.4°C |
לחץ אדים |
0.00452mmHg at 25°C |
Hazard סימנים |
Xn:Harmful;
|
סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
בטיחות תיאור |
S36/37:Wear suitable protective clothing and gloves.;
|
|