ChemNet > CAS > 2157-56-4 2,4-Pentanedione dioxime
2157-56-4 2,4-Pentanedione dioxime
| שם המוצר |
2,4-Pentanedione dioxime |
| שם אנגלי |
2,4-Pentanedione dioxime; Acetylacetone dioxime; N,N'-dihydroxypentane-2,4-diimine; (2Z,4Z)-pentane-2,4-dione dioxime; (2Z,4E)-pentane-2,4-dione dioxime; (2Z)-pentane-2,4-dione dioxime |
| מולקולרית פורמולה |
C5H10N2O2 |
| משקל מולקולרי |
130.1451 |
| InChI |
InChI=1/C5H10N2O2/c1-4(6-8)3-5(2)7-9/h8-9H,3H2,1-2H3/b6-4-,7-5u |
| מספר CAS |
2157-56-4 |
| EINECS |
218-472-3 |
| מבנה מולקולרי |
|
| צפיפות |
1.13g/cm3 |
| נקודת ההתוך |
146-148℃ |
| נקודת רתיחה |
298.8°C at 760 mmHg |
| משקל סגולי |
1.486 |
| נקודת הבזק |
179.3°C |
| לחץ אדים |
0.000294mmHg at 25°C |
| Hazard סימנים |
|
| סיכונים קודי |
|
| בטיחות תיאור |
S24/25:Avoid contact with skin and eyes.;
|
|
