ChemNet > CAS > 220141-71-9 3,5-Difluorobenzylchloride
220141-71-9 3,5-Difluorobenzylchloride
| שם המוצר |
3,5-Difluorobenzylchloride |
| שם אנגלי |
3,5-Difluorobenzylchloride; 3,5-Difluorobenzyl chloride; 1-(chloromethyl)-3,5-difluorobenzene |
| מולקולרית פורמולה |
C7H5ClF2 |
| משקל מולקולרי |
162.5644 |
| InChI |
InChI=1/C7H5ClF2/c8-4-5-1-6(9)3-7(10)2-5/h1-3H,4H2 |
| מספר CAS |
220141-71-9 |
| מבנה מולקולרי |
|
| צפיפות |
1.294g/cm3 |
| נקודת רתיחה |
164.5°C at 760 mmHg |
| משקל סגולי |
1.485 |
| נקודת הבזק |
56.2°C |
| לחץ אדים |
2.57mmHg at 25°C |
| Hazard סימנים |
|
| סיכונים קודי |
R34:Causes burns.;
|
| בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
