ChemNet > CAS > 2315-86-8 3-Bromo-4-hydroxybenzonitrile
2315-86-8 3-Bromo-4-hydroxybenzonitrile
שם המוצר |
3-Bromo-4-hydroxybenzonitrile |
שם אנגלי |
3-Bromo-4-hydroxybenzonitrile; 2-Bromo-4-cyanophenol |
מולקולרית פורמולה |
C7H4BrNO |
משקל מולקולרי |
198.0168 |
InChI |
InChI=1/C7H4BrNO/c8-6-3-5(4-9)1-2-7(6)10/h1-3,10H |
מספר CAS |
2315-86-8 |
EINECS |
219-022-9 |
מבנה מולקולרי |
|
צפיפות |
1.79g/cm3 |
נקודת ההתוך |
155℃ |
נקודת רתיחה |
271.1°C at 760 mmHg |
משקל סגולי |
1.656 |
נקודת הבזק |
117.8°C |
לחץ אדים |
0.00396mmHg at 25°C |
Hazard סימנים |
Xn:Harmful;
|
סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
בטיחות תיאור |
S36/37:Wear suitable protective clothing and gloves.;
|
|