ChemNet > CAS > 23165-60-8 4-Methoxy-2-nitrophenyl isothiocyanate
23165-60-8 4-Methoxy-2-nitrophenyl isothiocyanate
| שם המוצר |
4-Methoxy-2-nitrophenyl isothiocyanate |
| שם אנגלי |
4-Methoxy-2-nitrophenyl isothiocyanate;1-isothiocyanato-4-methoxy-2-nitrobenzene |
| מולקולרית פורמולה |
C8H6N2O3S |
| משקל מולקולרי |
210.2098 |
| InChI |
InChI=1/C8H6N2O3S/c1-13-6-2-3-7(9-5-14)8(4-6)10(11)12/h2-4H,1H3 |
| מספר CAS |
23165-60-8 |
| מבנה מולקולרי |
|
| צפיפות |
1.33g/cm3 |
| נקודת רתיחה |
380.7°C at 760 mmHg |
| משקל סגולי |
1.604 |
| נקודת הבזק |
184°C |
| לחץ אדים |
1.17E-05mmHg at 25°C |
| Hazard סימנים |
|
| סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
