ChemNet > CAS > 2362-64-3 4-Methoxythiobenzamide
2362-64-3 4-Methoxythiobenzamide
| שם המוצר |
4-Methoxythiobenzamide |
| שם אנגלי |
4-Methoxythiobenzamide;Benzenecarbothioamide, 4-methoxy-; Thio-p-anisamide; 4-methoxybenzenecarbothioamide |
| מולקולרית פורמולה |
C8H9NOS |
| משקל מולקולרי |
167.2282 |
| InChI |
InChI=1/C8H9NOS/c1-10-7-4-2-6(3-5-7)8(9)11/h2-5H,1H3,(H2,9,11) |
| מספר CAS |
2362-64-3 |
| מבנה מולקולרי |
|
| צפיפות |
1.194g/cm3 |
| נקודת רתיחה |
288.5°C at 760 mmHg |
| משקל סגולי |
1.619 |
| נקודת הבזק |
128.3°C |
| לחץ אדים |
0.00233mmHg at 25°C |
| Hazard סימנים |
|
| סיכונים קודי |
R20/22:Harmful by inhalation and if swallowed.;
|
| בטיחות תיאור |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
