2385-77-5 ( )-ציטרונלל
שם המוצר |
( )-ציטרונלל |
נרדפות |
;(R)-( )-Citronellal; (R)-( )-3,7-Dimethyl-6-octenal |
שם אנגלי |
(+)-citronellal; (R)-(+)-Citronellal; (R)-(+)-3,7-Dimethyl-6-octenal |
מולקולרית פורמולה |
C10H18O |
משקל מולקולרי |
154.25 |
InChI |
InChI=1/C10H18O/c1-9(2)5-4-6-10(3)7-8-11/h5,8,10H,4,6-7H2,1-3H3/t10-/m1/s1 |
מספר CAS |
2385-77-5 |
EINECS |
219-194-5 |
מבנה מולקולרי |
|
צפיפות |
0.8554 |
נקודת רתיחה |
201-204℃ |
משקל סגולי |
1.4467 |
נקודת הבזק |
78℃ |
Hazard סימנים |
Xi:Irritant;
|
סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|