2401-24-3 6-Chloro-m-anisidine
שם המוצר |
6-Chloro-m-anisidine |
שם אנגלי |
6-Chloro-m-anisidine; 2-Chloro-5-methoxyaniline; 6-chloro-meta-anisidine; 3-Amino-4-chloroanisole |
מולקולרית פורמולה |
C7H9Cl2NO |
משקל מולקולרי |
194.0585 |
InChI |
InChI=1/C7H8ClNO.ClH/c1-10-5-2-3-6(8)7(9)4-5;/h2-4H,9H2,1H3;1H |
מספר CAS |
2401-24-3 |
EINECS |
219-277-6 |
מבנה מולקולרי |
|
נקודת ההתוך |
207℃ |
נקודת רתיחה |
255°C at 760 mmHg |
נקודת הבזק |
108°C |
לחץ אדים |
0.0168mmHg at 25°C |
Hazard סימנים |
Xn:Harmful;
|
סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
בטיחות תיאור |
S36/37:Wear suitable protective clothing and gloves.;
|
|