ChemNet > CAS > 25154-52-3 4-(2,6-Dimethylheptyl)phenol(O and P)
25154-52-3;1300-16-9 4-(2,6-Dimethylheptyl)phenol(O and P)
שם המוצר |
4-(2,6-Dimethylheptyl)phenol(O and P) |
שם אנגלי |
4-(2,6-Dimethylheptyl)phenol(O and P); 2,6-dimethyl-4-heptylphenol,(oandp); hydroxylno.253; monononylphenol; n-nonylphenol; nonyl; nonyl-pheno; nonylphenol(isomermixture); nonylphenol; Nonyl phenol; potassium 2-nonylphenolate; strontium bis(2-nonylphenolate); sodium 2-nonylphenolate; 4-(2,6-dimethylheptyl)phenol; 4-(1,3,5-trimethylhexyl)phenol |
מולקולרית פורמולה |
C15H24O |
משקל מולקולרי |
220.3505 |
InChI |
InChI=1/C15H24O/c1-11(2)9-12(3)10-13(4)14-5-7-15(16)8-6-14/h5-8,11-13,16H,9-10H2,1-4H3 |
מספר CAS |
25154-52-3;1300-16-9 |
EINECS |
246-672-0 |
מבנה מולקולרי |
|
צפיפות |
0.926g/cm3 |
נקודת ההתוך |
-8℃ |
נקודת רתיחה |
306.7°C at 760 mmHg |
משקל סגולי |
1.5 |
נקודת הבזק |
156.2°C |
מסיסות במים |
6 mg l-1 |
לחץ אדים |
0.000418mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
|
בטיחות תיאור |
|
|