ChemNet > CAS > 2719-15-5 2-Methyl-4-nitroacetanilide
2719-15-5 2-Methyl-4-nitroacetanilide
| שם המוצר |
2-Methyl-4-nitroacetanilide |
| שם אנגלי |
2-Methyl-4-nitroacetanilide; N1-(2-Methyl-4-nitrophenyl)acetamide; N-(2-methyl-4-nitrophenyl)acetamide |
| מולקולרית פורמולה |
C9H10N2O3 |
| משקל מולקולרי |
194.1873 |
| InChI |
InChI=1/C9H10N2O3/c1-6-5-8(11(13)14)3-4-9(6)10-7(2)12/h3-5H,1-2H3,(H,10,12) |
| מספר CAS |
2719-15-5 |
| מבנה מולקולרי |
|
| צפיפות |
1.289g/cm3 |
| נקודת ההתוך |
198-200℃ |
| נקודת רתיחה |
393.3°C at 760 mmHg |
| משקל סגולי |
1.605 |
| נקודת הבזק |
191.7°C |
| לחץ אדים |
2.15E-06mmHg at 25°C |
| Hazard סימנים |
 Xn:Harmful;
|
| סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| בטיחות תיאור |
S36/37:Wear suitable protective clothing and gloves.;
|
|
