ChemNet > CAS > 2783-17-7 1,12-diaminododecane
2783-17-7 1,12-diaminododecane
| שם המוצר |
1,12-diaminododecane |
| שם אנגלי |
1,12-diaminododecane; Diaminododecane; dodecamethylenediamine; 1,12-Dodecanediamine; 1,12-Dodecyl diamine; dodecane-1,12-diamine; dodecane-1,12-diaminium dichloride; dodecane-1,1-diamine |
| מולקולרית פורמולה |
C12H28N2 |
| משקל מולקולרי |
200.3641 |
| InChI |
InChI=1/C12H28N2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h12H,2-11,13-14H2,1H3 |
| מספר CAS |
2783-17-7 |
| EINECS |
220-489-6 |
| מבנה מולקולרי |
|
| צפיפות |
0.855g/cm3 |
| נקודת ההתוך |
69-71℃ |
| נקודת רתיחה |
283.84°C at 760 mmHg |
| משקל סגולי |
1.464 |
| נקודת הבזק |
155.577°C |
| לחץ אדים |
0.003mmHg at 25°C |
| Hazard סימנים |
|
| סיכונים קודי |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
