ChemNet > CAS > 28804-88-8 Dimethylnaphthalene, mixture of isomers
28804-88-8 Dimethylnaphthalene, mixture of isomers
שם המוצר |
Dimethylnaphthalene, mixture of isomers |
שם אנגלי |
Dimethylnaphthalene, mixture of isomers; naphthalene, 1,2-dimethyl-; 1,2-dimethyl-naphthalene |
מולקולרית פורמולה |
C12H12 |
משקל מולקולרי |
156.2237 |
InChI |
InChI=1/C12H12/c1-9-3-5-12-8-10(2)4-6-11(12)7-9/h3-8H,1-2H3 |
מספר CAS |
28804-88-8 |
EINECS |
249-241-5 |
מבנה מולקולרי |
|
צפיפות |
1g/cm3 |
נקודת רתיחה |
264.4°C at 760 mmHg |
משקל סגולי |
1.604 |
נקודת הבזק |
110.5°C |
לחץ אדים |
0.0159mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
|
בטיחות תיאור |
S24/25:Avoid contact with skin and eyes.;
|
|