ChemNet > CAS > 2946-61-4 Dimethyl phenylphosphonite
2946-61-4 Dimethyl phenylphosphonite
שם המוצר |
Dimethyl phenylphosphonite |
שם אנגלי |
Dimethyl phenylphosphonite; Dimethoxyphenylphosphine; Phenyldimethoxyphosphine; Phenylphosphonous acid dimethyl ester |
מולקולרית פורמולה |
C8H11O2P |
משקל מולקולרי |
170.1455 |
InChI |
InChI=1/C8H11O2P/c1-9-11(10-2)8-6-4-3-5-7-8/h3-7H,1-2H3 |
מספר CAS |
2946-61-4 |
EINECS |
220-960-6 |
מבנה מולקולרי |
|
נקודת רתיחה |
194.1°C at 760 mmHg |
נקודת הבזק |
81°C |
לחץ אדים |
0.628mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
|
בטיחות תיאור |
S24/25:Avoid contact with skin and eyes.;
|
|