ChemNet > CAS > 30711-40-1 2-(n-Heptanoyl)thiophene
30711-40-1 2-(n-Heptanoyl)thiophene
| שם המוצר |
2-(n-Heptanoyl)thiophene |
| שם אנגלי |
2-(n-Heptanoyl)thiophene; 1-(2-Thienoyl)hexane; 1-(thiophen-2-yl)heptan-1-one |
| מולקולרית פורמולה |
C11H16OS |
| משקל מולקולרי |
196.3091 |
| InChI |
InChI=1/C11H16OS/c1-2-3-4-5-7-10(12)11-8-6-9-13-11/h6,8-9H,2-5,7H2,1H3 |
| מספר CAS |
30711-40-1 |
| מבנה מולקולרי |
|
| צפיפות |
1.017g/cm3 |
| נקודת רתיחה |
295.9°C at 760 mmHg |
| משקל סגולי |
1.511 |
| נקודת הבזק |
132.7°C |
| לחץ אדים |
0.00149mmHg at 25°C |
| Hazard סימנים |
|
| סיכונים קודי |
|
| בטיחות תיאור |
S24/25:Avoid contact with skin and eyes.;
|
|
