320-65-0 2-fluorobenzal chloride

שם המוצר	2-fluorobenzal chloride
שם אנגלי	2-fluorobenzal chloride; alpha,alpha-Dichloro-2-fluorotoluene
מולקולרית פורמולה	C₇H₅Cl₂F
משקל מולקולרי	179.02
InChI	InChI=1/C7H5Cl2F/c8-7(9)5-3-1-2-4-6(5)10/h1-4,7H
מספר CAS	320-65-0
EINECS	206-279-7
מבנה מולקולרי
צפיפות	1.3
נקודת רתיחה	224℃
Hazard סימנים
סיכונים קודי	R34:Causes burns.; R36:Irritating to eyes.;
בטיחות תיאור	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;