ChemNet > CAS > 32690-28-1 4,5-Dinitro-o-phenylenediamine
32690-28-1 4,5-Dinitro-o-phenylenediamine
שם המוצר |
4,5-Dinitro-o-phenylenediamine |
שם אנגלי |
4,5-Dinitro-o-phenylenediamine; 4,5-Dinitro-1,2-diaminobenzene; 4,5-dinitrobenzene-1,2-diamine |
מולקולרית פורמולה |
C6H6N4O4 |
משקל מולקולרי |
198.1362 |
InChI |
InChI=1/C6H6N4O4/c7-3-1-5(9(11)12)6(10(13)14)2-4(3)8/h1-2H,7-8H2 |
מספר CAS |
32690-28-1 |
מבנה מולקולרי |
|
צפיפות |
1.683g/cm3 |
נקודת ההתוך |
213℃ |
נקודת רתיחה |
541.1°C at 760 mmHg |
משקל סגולי |
1.747 |
נקודת הבזק |
281°C |
לחץ אדים |
8.98E-12mmHg at 25°C |
Hazard סימנים |
Xn:Harmful;
|
סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
בטיחות תיאור |
S36/37:Wear suitable protective clothing and gloves.;
|
|