ChemNet > CAS > 32890-89-4 2-Chloro-6-fluoro-3-methylbenzoic acid
32890-89-4 2-Chloro-6-fluoro-3-methylbenzoic acid
שם המוצר |
2-Chloro-6-fluoro-3-methylbenzoic acid |
שם אנגלי |
2-Chloro-6-fluoro-3-methylbenzoic acid; 2-Chloro-6-fluoro-m-toluic acid |
מולקולרית פורמולה |
C8H6ClFO2 |
משקל מולקולרי |
188.5834 |
InChI |
InChI=1/C8H6ClFO2/c1-4-2-3-5(10)6(7(4)9)8(11)12/h2-3H,1H3,(H,11,12) |
מספר CAS |
32890-89-4 |
מבנה מולקולרי |
|
צפיפות |
1.403g/cm3 |
נקודת רתיחה |
278.1°C at 760 mmHg |
משקל סגולי |
1.551 |
נקודת הבזק |
122°C |
לחץ אדים |
0.00209mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|