ChemNet > CAS > 3321-92-4 3',5'-dichloro-2'-hydroxyacetophenone
3321-92-4 3',5'-dichloro-2'-hydroxyacetophenone
שם המוצר |
3',5'-dichloro-2'-hydroxyacetophenone |
שם אנגלי |
3',5'-dichloro-2'-hydroxyacetophenone; 3,5-Dichloro-2-hydroxyacetophenone; 1-(3,5-dichloro-2-hydroxyphenyl)ethanone |
מולקולרית פורמולה |
C8H6Cl2O2 |
משקל מולקולרי |
205.038 |
InChI |
InChI=1/C8H6Cl2O2/c1-4(11)6-2-5(9)3-7(10)8(6)12/h2-3,12H,1H3 |
מספר CAS |
3321-92-4 |
מבנה מולקולרי |
|
צפיפות |
1.43g/cm3 |
נקודת ההתוך |
94-97℃ |
נקודת רתיחה |
295.6°C at 760 mmHg |
משקל סגולי |
1.583 |
נקודת הבזק |
132.6°C |
לחץ אדים |
0.000856mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|