ChemNet > CAS > 33733-73-2 3-Bromothioanisole
33733-73-2 3-Bromothioanisole
| שם המוצר |
3-Bromothioanisole |
| שם אנגלי |
3-Bromothioanisole; 3-Bromophenyl methyl sulphide; 3-Bromothioanisol/3-Bromophenyl methyl sulphide; 1-Bromo-3-(methylthio)benzene; m-Bromothioanisole; 1-bromo-3-(methylsulfanyl)benzene; 1-(bromosulfanyl)-3-methoxybenzene |
| מולקולרית פורמולה |
C7H7BrOS |
| משקל מולקולרי |
219.0989 |
| InChI |
InChI=1/C7H7BrOS/c1-9-6-3-2-4-7(5-6)10-8/h2-5H,1H3 |
| מספר CAS |
33733-73-2 |
| מבנה מולקולרי |
|
| צפיפות |
1.567g/cm3 |
| נקודת רתיחה |
278.106°C at 760 mmHg |
| משקל סגולי |
1.616 |
| נקודת הבזק |
121.995°C |
| לחץ אדים |
0.007mmHg at 25°C |
| Hazard סימנים |
|
| סיכונים קודי |
R36/38:Irritating to eyes and skin.;
|
| בטיחות תיאור |
S23:;
S24/25:;
|
|
