ChemNet > CAS > 33775-94-9 2-Iodothioanisole
33775-94-9 2-Iodothioanisole
שם המוצר |
2-Iodothioanisole |
שם אנגלי |
2-Iodothioanisole; 2-Iodophenyl methyl sulphide~2-(Methylthio)iodobenzene; 1-Iodo-2-(methylthio)benzene; 1-iodo-2-(methylsulfanyl)benzene |
מולקולרית פורמולה |
C7H7IS |
משקל מולקולרי |
250.0999 |
InChI |
InChI=1/C7H7IS/c1-9-7-5-3-2-4-6(7)8/h2-5H,1H3 |
מספר CAS |
33775-94-9 |
מבנה מולקולרי |
|
צפיפות |
1.78g/cm3 |
נקודת רתיחה |
253°C at 760 mmHg |
משקל סגולי |
1.67 |
נקודת הבזק |
106.8°C |
לחץ אדים |
0.0298mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
|
בטיחות תיאור |
S24/25:Avoid contact with skin and eyes.;
|
|