33797-51-2 Eschenmoser's salt
שם המוצר |
Eschenmoser's salt |
שם אנגלי |
Eschenmoser's salt; Dimethyl methyleneammonium iodide; Eschenmosers iodide salt; N,N-Dimethylmethyleneiminium iodide; Eschenmoser salt; N-methyl-N-methylidenemethanaminium iodide |
מולקולרית פורמולה |
C3H8IN |
משקל מולקולרי |
185.0068 |
InChI |
InChI=1/C3H8N.HI/c1-4(2)3;/h1H2,2-3H3;1H/q+1;/p-1 |
מספר CAS |
33797-51-2 |
EINECS |
251-680-2 |
מבנה מולקולרי |
|
נקודת ההתוך |
219℃ |
Hazard סימנים |
Xi:Irritant;
|
סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|