344-14-9 dimethyl fluoromalonate
שם המוצר |
dimethyl fluoromalonate |
שם אנגלי |
dimethyl fluoromalonate; Fluoromalonic acid dimethyl ester; dimethyl fluoropropanedioate; 2-Fluoro-malonic acid dimethyl ester |
מולקולרית פורמולה |
C5H7FO4 |
משקל מולקולרי |
150.1051 |
InChI |
InChI=1/C5H7FO4/c1-9-4(7)3(6)5(8)10-2/h3H,1-2H3 |
מספר CAS |
344-14-9 |
מבנה מולקולרי |
|
צפיפות |
1.211g/cm3 |
נקודת רתיחה |
140.3°C at 760 mmHg |
משקל סגולי |
1.382 |
נקודת הבזק |
38.4°C |
לחץ אדים |
6.18mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
R34:Causes burns.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|