ChemNet > CAS > 34590-94-8 dipropylene glycol monomethyl ether, mixture of isomers
34590-94-8 dipropylene glycol monomethyl ether, mixture of isomers
שם המוצר |
dipropylene glycol monomethyl ether, mixture of isomers |
שם אנגלי |
dipropylene glycol monomethyl ether, mixture of isomers; Di(propylene glycol) methyl ether; Methoxypropoxypropanol; Dipropylene glycol monomethyl ether; DPM |
מולקולרית פורמולה |
C7H16O3 |
משקל מולקולרי |
148.2001 |
InChI |
InChI=1/C7H16O3/c1-3-7(8)10-6-4-5-9-2/h7-8H,3-6H2,1-2H3 |
מספר CAS |
34590-94-8 |
EINECS |
252-104-2 |
מבנה מולקולרי |
|
צפיפות |
0.958g/cm3 |
נקודת רתיחה |
155.6°C at 760 mmHg |
משקל סגולי |
1.423 |
נקודת הבזק |
47.9°C |
לחץ אדים |
1.09mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
|
בטיחות תיאור |
S23:;
S24/25:;
|
|