ChemNet > CAS > 3460-49-9 4-Isothiocyanatophenetol
3460-49-9 4-Isothiocyanatophenetol
| שם המוצר |
4-Isothiocyanatophenetol |
| שם אנגלי |
4-Isothiocyanatophenetol; 4-Ethoxyphenyl isothiocyanate; 1-ethoxy-4-isothiocyanatobenzene |
| מולקולרית פורמולה |
C9H9NOS |
| משקל מולקולרי |
179.2389 |
| InChI |
InChI=1/C9H9NOS/c1-2-11-9-5-3-8(4-6-9)10-7-12/h3-6H,2H2,1H3 |
| מספר CAS |
3460-49-9 |
| EINECS |
222-410-0 |
| מבנה מולקולרי |
|
| צפיפות |
1.06g/cm3 |
| נקודת רתיחה |
288.7°C at 760 mmHg |
| משקל סגולי |
1.544 |
| נקודת הבזק |
128.4°C |
| לחץ אדים |
0.004mmHg at 25°C |
| Hazard סימנים |
|
| סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
