3468-53-9 Phenyl nicotinate
שם המוצר |
Phenyl nicotinate |
שם אנגלי |
Phenyl nicotinate; Phenyl nicotinate, (Nicotinic acid phenyl ester; Nicotinic acid phenyl ester~Phenyl pyridine-3-carboxylate; phenyl pyridine-3-carboxylate |
מולקולרית פורמולה |
C12H9NO2 |
משקל מולקולרי |
199.2054 |
InChI |
InChI=1/C12H9NO2/c14-12(10-5-4-8-13-9-10)15-11-6-2-1-3-7-11/h1-9H |
מספר CAS |
3468-53-9 |
EINECS |
222-428-9 |
מבנה מולקולרי |
|
צפיפות |
1.199g/cm3 |
נקודת ההתוך |
70-72℃ |
נקודת רתיחה |
338.9°C at 760 mmHg |
משקל סגולי |
1.589 |
נקודת הבזק |
158.8°C |
לחץ אדים |
9.51E-05mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
R43:May cause sensitization by skin contact.;
|
בטיחות תיאור |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|