347-63-7 3-(3-Fluoro-4-methoxybenzoyl)propionic acid

שם המוצר	3-(3-Fluoro-4-methoxybenzoyl)propionic acid
שם אנגלי	3-(3-Fluoro-4-methoxybenzoyl)propionic acid;
מולקולרית פורמולה	C₁₁H₁₁FO₄
משקל מולקולרי	226.20
InChI	InChI=1/C11H11FO4/c1-16-10-4-2-7(6-8(10)12)9(13)3-5-11(14)15/h2,4,6H,3,5H2,1H3,(H,14,15)
מספר CAS	347-63-7
EINECS	206-474-7
מבנה מולקולרי
Hazard סימנים
סיכונים קודי	R36/37/38:Irritating to eyes, respiratory system and skin.;
בטיחות תיאור	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;