ChemNet > CAS > 35884-42-5 di(propylene glycol) butyl ether, mixture of
35884-42-5 di(propylene glycol) butyl ether, mixture of
שם המוצר |
di(propylene glycol) butyl ether, mixture of |
שם אנגלי |
di(propylene glycol) butyl ether, mixture of; Di(propylene glycol) butyl ether,mixture of isomers; 1-(3-butoxypropoxy)propan-1-ol; Dipropylene glycol butyl ether |
מולקולרית פורמולה |
C10H22O3 |
משקל מולקולרי |
190.2799 |
InChI |
InChI=1/C10H22O3/c1-3-5-7-12-8-6-9-13-10(11)4-2/h10-11H,3-9H2,1-2H3 |
מספר CAS |
35884-42-5 |
EINECS |
252-776-7 |
מבנה מולקולרי |
|
צפיפות |
0.931g/cm3 |
נקודת רתיחה |
221.1°C at 760 mmHg |
משקל סגולי |
1.435 |
נקודת הבזק |
87.5°C |
לחץ אדים |
0.0226mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
|
בטיחות תיאור |
|
|