ChemNet > CAS > 39499-34-8 5-Methylisoxazole-3-carbonyl chloride
39499-34-8 5-Methylisoxazole-3-carbonyl chloride
שם המוצר |
5-Methylisoxazole-3-carbonyl chloride |
שם אנגלי |
5-Methylisoxazole-3-carbonyl chloride; |
מולקולרית פורמולה |
C5H4ClNO2 |
משקל מולקולרי |
145.5438 |
InChI |
InChI=1/C5H4ClNO2/c1-3-2-4(5(6)8)7-9-3/h2H,1H3 |
מספר CAS |
39499-34-8 |
EINECS |
254-475-6 |
מבנה מולקולרי |
|
צפיפות |
1.345g/cm3 |
נקודת רתיחה |
243.7°C at 760 mmHg |
משקל סגולי |
1.498 |
נקודת הבזק |
101.2°C |
לחץ אדים |
0.0317mmHg at 25°C |
Hazard סימנים |
C:Corrosive;
|
סיכונים קודי |
R34:Causes burns.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|