ChemNet > CAS > 41825-73-4 2-Bromo-4,6-dimethylaniline
41825-73-4 2-Bromo-4,6-dimethylaniline
| שם המוצר |
2-Bromo-4,6-dimethylaniline |
| שם אנגלי |
2-Bromo-4,6-dimethylaniline; Benzenamine, 2-bromo-4,6-dimethyl-; 2-Bromo-4,6-dimethylbenzenamine |
| מולקולרית פורמולה |
C8H10BrN |
| משקל מולקולרי |
200.0757 |
| InChI |
InChI=1/C8H10BrN/c1-5-3-6(2)8(10)7(9)4-5/h3-4H,10H2,1-2H3 |
| מספר CAS |
41825-73-4 |
| EINECS |
246-337-9 |
| מבנה מולקולרי |
|
| צפיפות |
1.424g/cm3 |
| נקודת ההתוך |
49-79℃ |
| נקודת רתיחה |
260.9°C at 760 mmHg |
| משקל סגולי |
1.596 |
| נקודת הבזק |
111.6°C |
| לחץ אדים |
0.0119mmHg at 25°C |
| Hazard סימנים |
|
| סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
